| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (2R,3R)-(+)-Bis(diphenylphosphino)butane Basic information |
| Product Name: | (2R,3R)-(+)-Bis(diphenylphosphino)butane | | Synonyms: | (2R,3R)-(+)-2,3-BIS(DIPHENYL PHOSPHINO)BUTANE;(2R,3R)-(+)-Bis(diphenylphosphino)butane, (R,R)-CHIRAPHOS;(R,R)-Chiraphos,97%;(2R,3R)-(+)-Bis(diphenylphosphino)butane, 98% (R,R)-CHIRAPHOS;(2R,3R)-(+)-2,3-Bis(diphenylphosphino)butane (R,R)-CHIRAPHOS;2,3-Bis(diphenylphosphino)butane;(2R,3R)-Butane-2,3-diylbis(diphenylphosphine);1,1'-[(1R,2R)-1,2-Dimethyl-1,2-ethanediyl]bis[1,1-diphenyl-phosphine | | CAS: | 74839-84-2 | | MF: | C28H28P2 | | MW: | 426.47 | | EINECS: | | | Product Categories: | Chiral Phosphine;Pharmaceutical Intermediates | | Mol File: | 74839-84-2.mol |  |
| | (2R,3R)-(+)-Bis(diphenylphosphino)butane Chemical Properties |
| Melting point | 104-109 °C | | Boiling point | 529.2±33.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | white | | Sensitive | Air Sensitive | | InChI | 1S/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/m1/s1 | | InChIKey | FWXAUDSWDBGCMN-DNQXCXABSA-N | | SMILES | C[C@H]([C@@H](C)P(c1ccccc1)c2ccccc2)P(c3ccccc3)c4ccccc4 | | CAS DataBase Reference | 74839-84-2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36/37/39-26-37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | (2R,3R)-(+)-Bis(diphenylphosphino)butane Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | (2R,3R)-Bis(diphenylphosphino)butane is a reagent used in the synthesis of endothelin A receptor antagonists. Also used in the synthesis of (R)-Tolterodine and (S)-Tolterodine. | | Purification Methods | It recrystallises from absolute EtOH (~6g in 60mL) as colourless plates [Fryzuk & Bosnich J Am Chem Soc 99 6262 1977, Fryzuk & Bosnich J Am Chem Soc 101 3043 1979]. |
| | (2R,3R)-(+)-Bis(diphenylphosphino)butane Preparation Products And Raw materials |
|