|
|
| | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE Basic information | | Uses Reaction |
| Product Name: | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE | | Synonyms: | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE;(2S,3S)-(-)-2,3-BIS(DIPHENYLPHOSPHINO)BUTANE;(2S,3S)-(-)-Bis(diphenylphosphino)butane (S,S)-CHIRAPHOS, min. 98%;Chiraphos, bis(diphenylphosphino)-2,3 butane;(S,S)-CHIRAPHOS;(2S,3S)-(-)-Bis(diphenylphosphino)butane,(S,S)-CHIRAPHOS;(2S 3S)-(-)-2 3-BIS(DIPHENYLPHOSPHINO)-&;(2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE (S,S)-CHIRAPHOS, (C=1.5,CHCL3) | | CAS: | 64896-28-2 | | MF: | C28H28P2 | | MW: | 426.47 | | EINECS: | | | Product Categories: | Chiral Phosphine;organophosphine ligand;Asymmetric Synthesis;Phosphine Ligands;Synthetic Organic Chemistry | | Mol File: | 64896-28-2.mol |  |
| | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE Chemical Properties |
| Melting point | 104-109 °C | | alpha | D27 -211° (c = 1.5 in CHCl3) | | Boiling point | 529.2±33.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Acetonitrile, Chloroform | | form | crystal | | color | white | | Optical Rotation | [α]22/D 191°, c = 1.5 in chloroform | | Sensitive | Air Sensitive | | Merck | 14,2063 | | BRN | 4268869 | | InChI | InChI=1/C28H28P2/c1-23(29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24(2)30(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24H,1-2H3/t23-,24-/s3 | | InChIKey | FWXAUDSWDBGCMN-DPVGMKQNNA-N | | SMILES | P([C@@H](C)[C@H](C)P(C1C=CC=CC=1)C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 |&1:1,3,r| | | CAS DataBase Reference | 64896-28-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| Provider | Language |
|
ACROS
| English |
| | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE Usage And Synthesis |
| Uses | (2S,3S)-(-)-Bis(diphenylphosphino)butane, also known as (S,S)-Chiraphos, is a chiral ligand used in the preparation of bimetallic chromium and diphosphine-ruthenium (II) diallyl complexes. | | Reaction | Useful as a ligand in the Ni-catalyzed asymmetric additions to allylic ketals.
| | Chemical Properties | white granular powder | | Uses | Ligand for palladium-catalyzed carbon-carbon bond formation. | | Uses | Ligand for Pd-catalyzed carbon-carbon bond formation. | | Uses | (2S,3S)-(-)-Bis(diphenylphosphino)butane, also known as (S,S)-Chiraphos, is a chiral ligand used in the preparation of bimetallic chromium and diphosphine-ruthenium (II) diallyl complexes. |
| | (2S,3S)-(-)-BIS(DIPHENYLPHOSPHINO)BUTANE Preparation Products And Raw materials |
|