|
|
| | 4-Nitrophenyl-beta-D-glucuronic acid, sodium salt Basic information |
| Product Name: | 4-Nitrophenyl-beta-D-glucuronic acid, sodium salt | | Synonyms: | P-NITROPHENYL-BETA-D-GLUCURONIDE, SODIUM SALT;PNP-BETA-D-GLCA NA;4-Nitrophenylb-D-glucuronidesodiumsalt;4-Nitrophenyl β-D-glucuronide sodium salt;b-D-Glucopyranosiduronic acid,4-nitrophenyl, monosodium salt;4-nitrophenyl-β-D-glucuronide sodium;4-Nitrophenyl-beta-D-glucuronide sodium;Sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitro-phenoxy)tetrahydro-2H-pyran-2-carboxylate | | CAS: | 89772-41-8 | | MF: | C12H14NNaO9 | | MW: | 339.23 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 89772-41-8.mol |  |
| | 4-Nitrophenyl-beta-D-glucuronic acid, sodium salt Chemical Properties |
| Melting point | 150 - 153°C | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated, Sonicated), Water (Slightly) | | form | Solid | | color | Light Yellow to Yellow | | InChI | InChI=1/C12H13NO9.Na.H/c14-7-8(15)10(11(17)18)22-12(9(7)16)21-6-3-1-5(2-4-6)13(19)20;;/h1-4,7-10,12,14-16H,(H,17,18);;/t7-,8-,9+,10-,12+;;/s3 | | InChIKey | DGWOCLOXPSOLGV-VJVGCFLWNA-N | | SMILES | O(C1C=CC(N(=O)=O)=CC=1)[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](C(=O)O)O1)O.[NaH] |&1:10,11,12,14,16,r| |
| | 4-Nitrophenyl-beta-D-glucuronic acid, sodium salt Usage And Synthesis |
| Uses | p-Nitrophenyl β-D-Glucuronide Sodium Salt (cas# 89772-41-8) is a compound useful in organic synthesis. |
| | 4-Nitrophenyl-beta-D-glucuronic acid, sodium salt Preparation Products And Raw materials |
|