|
|
| | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Basic information |
| | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Chemical Properties |
| Boiling point | 158.5±35.0 °C(Predicted) | | density | 1.724±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | color | Pale yellow | | InChI | InChI=1S/C7H3BrF4O/c8-5-2-1-4(3-6(5)9)13-7(10,11)12/h1-3H | | InChIKey | KZMHSGBETSENAT-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(OC(F)(F)F)C=C1F | | CAS DataBase Reference | 168971-68-4(CAS DataBase Reference) |
| | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Usage And Synthesis |
| Uses | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene can be used as a synthetic intermediate in the field of chemical synthesis to prepare complex organic molecules containing trifluoromethoxy (OCF3), and is of great significance in medicinal chemistry and pesticide chemistry. |
| | 1-Bromo-2-fluoro-4-(trifluoromethoxy)benzene Preparation Products And Raw materials |
|