|
|
| | 2,5-Dimethoxycinnamic acid Basic information |
| | 2,5-Dimethoxycinnamic acid Chemical Properties |
| Melting point | 147-150°C | | Boiling point | 267.4°C (rough estimate) | | density | 1.0627 (rough estimate) | | refractive index | 1.4389 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.40±0.10(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C11H12O4/c1-14-9-4-5-10(15-2)8(7-9)3-6-11(12)13/h3-7H,1-2H3,(H,12,13) | | InChIKey | JPQWWJZORKTMIZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1=CC(OC)=CC=C1OC | | CAS DataBase Reference | 10538-51-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | 2,5-Dimethoxycinnamic acid Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | 2,5-Dimethoxycinnamic acid can be used as a pharmaceutical intermediate, and can be used in the synthesis of vasodilators such as cinnepazide. | | Preparation | Synthesis of 2,5-dimethoxycinnamic acid: 2,5-dimethoxybenzaldehyde, malonic acid and pyridine were added to 100ml three necks, piperidine was added at 90°C, refluxed for 2h, cooled to room temperature, and added 3mol/L hydrochloric acid, resulting in a large amount of white precipitate, suction filtration, the filter cake is washed with water, reconstituted with ethanol, after drying, 2,5-dimethoxycinnamic acid was obtained as pale yellow needle crystals. | | Definition | ChEBI: 2,5-Dimethoxycinnamic acid is a hydroxycinnamic acid. | | General Description | 2,5-Dimethoxycinnamic acid forms 1:1 molecular complex with 3,5-dinitrocinnamic acid. |
| | 2,5-Dimethoxycinnamic acid Preparation Products And Raw materials |
|