| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 4-Methyl-2-oxopentanoic-1-13C acid sod& Basic information |
| Product Name: | 4-Methyl-2-oxopentanoic-1-13C acid sod& | | Synonyms: | 2-Keto-4-methylpentanoic-1-13C acid sodium salt;4-METHYL-2-OXOPENTANOIC-1-13C ACID, SODI UM SALT, 99 ATOM % 13C;α-ketoisocaproic acid-1-13c sodium salt;2-Ketoisocaproic acid-1-13C sodium salt;2-Keto-4-methylpentanoic-1-13C acid sodium salt;4-Methyl-2-oxopentanoic-1-13C acid sod& | | CAS: | 93523-70-7 | | MF: | C6H9NaO3 | | MW: | 153.12 | | EINECS: | | | Product Categories: | | | Mol File: | 93523-70-7.mol |  |
| | 4-Methyl-2-oxopentanoic-1-13C acid sod& Chemical Properties |
| Melting point | 280 °C (dec.)(lit.) | | form | Solid | | color | White to off-white | | InChI | 1S/C6H10O3.Na/c1-4(2)3-5(7)6(8)9;/h4H,3H2,1-2H3,(H,8,9);/q;+1/p-1/i6+1; | | InChIKey | IXFAZKRLPPMQEO-NWZHYJCUSA-M | | SMILES | [Na+].CC(C)CC(=O)[13C]([O-])=O | | CAS Number Unlabeled | 4502-00-5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-Methyl-2-oxopentanoic-1-13C acid sod& Usage And Synthesis |
| Uses | 4-Methyl-2-oxopentanoic acid-13C (sodium) is the 13C labeled 4-Methyl-2-oxopentanoic acid sodium[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | 4-Methyl-2-oxopentanoic-1-13C acid sod& Preparation Products And Raw materials |
|