(2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid manufacturers
|
| | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid Basic information |
| Product Name: | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid | | Synonyms: | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid;(2-methoxy-9,9-dimethyL;uoren-3-yL;Boronic acid, B-(2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)-;B-(2-Methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid;(R)-[2,2’-bis(diphenylphosphino)-1,1’- | | CAS: | 2177237-24-8 | | MF: | C16H17BO3 | | MW: | 268.12 | | EINECS: | | | Product Categories: | | | Mol File: | 2177237-24-8.mol |  |
| | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid Chemical Properties |
| Boiling point | 461.4±55.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 8.50±0.40(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C16H17BO3/c1-16(2)12-7-5-4-6-10(12)11-8-14(17(18)19)15(20-3)9-13(11)16/h4-9,18-19H,1-3H3 | | InChIKey | ARBOJNRAVITBBB-UHFFFAOYSA-N | | SMILES | B(C1=CC2C3=C(C(C)(C)C=2C=C1OC)C=CC=C3)(O)O |
| | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid Usage And Synthesis |
| Uses | Used as an intermediate for OLED Materials synthesis. |
| | (2-methoxy-9,9-dimethyl-9H-fluoren-3-yl)boronic acid Preparation Products And Raw materials |
|