Boc-L-Cyclobutylglycine manufacturers
|
| | Boc-L-Cyclobutylglycine Basic information |
| Product Name: | Boc-L-Cyclobutylglycine | | Synonyms: | 2-cyclobutyl-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]acetic acid;(2S)-2-{[(tert-butoxy)carbonyl]amino}-2-cyclobutylacetic acid;BOC-S-CYCBUGLY-OH;BOC-L-CYCLOBUTYL GLYCINE;BOC-(2S)-GLY(2-CYCLOBUTYL);(S)-TERT-BUTOXYCARBONYLAMINO-CYCLOBUTYL-ACETIC ACID;(S)-N-ALPHA-T-BUTYLOXYCARBONYL-CYCLOBUTYLGLYCINE;BOC-L-CYCLOBUTYLGLYCINE 98% | | CAS: | 155905-77-4 | | MF: | C11H19NO4 | | MW: | 229.27 | | EINECS: | 200-110-4 | | Product Categories: | pharmacetical | | Mol File: | 155905-77-4.mol |  |
| | Boc-L-Cyclobutylglycine Chemical Properties |
| Boiling point | 379.1±25.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.06±0.10(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | 3°(C=0.01g/ml MEOH) | | InChI | InChI=1/C11H19NO4/c1-11(2,3)16-10(15)12-8(9(13)14)7-5-4-6-7/h7-8H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t8-/s3 | | InChIKey | OHDFGIXTRBDGRB-SBYBRXNCNA-N | | SMILES | C(=O)(OC(C)(C)C)N[C@@H](C1CCC1)C(O)=O |&1:8,r| |
| | Boc-L-Cyclobutylglycine Usage And Synthesis |
| Uses | Boc-L-cyclobutylglycine is a glycine derivative that can be used for PI3K inhibitor synthesis[1]. | | References | [1] Kim YS, et al. Synthesis and biological evaluation of novel purinyl quinazolinone derivatives as PI3Kδ-specific inhibitors for the treatment of hematologic malignancies. Bioorg Med Chem. 2021 Sep 1;45:116312. DOI:10.1016/j.bmc.2021.116312 |
| | Boc-L-Cyclobutylglycine Preparation Products And Raw materials |
|