- Fmoc-sta-oh
-
- $2.00
-
2026-08-25
- CAS:158257-40-0
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
- Fmoc-Sta-OH
-
- $1.00
-
2020-01-06
- CAS:158257-40-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | Fmoc-Sta-OH Basic information |
| Product Name: | Fmoc-Sta-OH | | Synonyms: | FMOC-STATINE;FMOC-LEU-STATINE;FMOC-(3S,4S)-4-AMINO-3-HYDROXY-6-METHYL HEPTANOIC ACID;FMOC-(3S,4S)-STA-OH;(3S,4S)-4-(FMOC-AMINO)-3-HYDROXY-6-METHYLHEPTANOIC ACID;(3S,4S)-N-(9-FLUOENYLMETHOXYCARBONYL)-4-AMINO-3-HYDROXY-6-METHYLHEPTANOIC ACID;(3S,4S)-N-(9-FLUORENYLMETHYLOXYCARBONYL)-STATINE;(3S,4S)-4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-3-hydroxy-6-methylheptanoic acid | | CAS: | 158257-40-0 | | MF: | C23H27NO5 | | MW: | 397.46 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 158257-40-0.mol |  |
| | Fmoc-Sta-OH Chemical Properties |
| Melting point | 92-94°C | | Boiling point | 628.2±55.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 4.22±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChIKey | JGUYYODGVQXZAY-SFTDATJTSA-N | | SMILES | C(O)(=O)C[C@H](O)[C@@H](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)CC(C)C | | CAS DataBase Reference | 158257-40-0(CAS DataBase Reference) |
| WGK Germany | WGK 2 water endangering | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Sta-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Sta-OH Preparation Products And Raw materials |
|