| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid Basic information |
| | 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid Chemical Properties |
| Melting point | 205-209 °C | | Boiling point | 425.3±45.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 0.52±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H6N2O2/c11-8(12)6-4-10-7-5(6)2-1-3-9-7/h1-4H,(H,9,10)(H,11,12) | | InChIKey | KYBIRFFGAIFLPM-UHFFFAOYSA-N | | SMILES | C12NC=C(C(O)=O)C1=CC=CN=2 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | Solid | | Uses | 7-Azaindole-3-carboxylic acid is a reactant for synthesis of azaindol derivatives as new acrosin inhibitors and for preparation of triazoles via regioselective heterocyclizaiton reactions. It is also a reactant for synthesis of azaindolylcarboxy-endo-tropanamide. | | Synthesis | (1) (1H-pyrrolo[2,3-b]pyridin-3-yl)methanol was used as a raw material and reacted with formaldehyde under microwave radiation at a molar ratio of 1:1.2. In the reaction system, the concentration of 7-azaindole to water was 1 mol/L, the molar ratio of 7-azaindole to tetramethylguanidine was 2:5, and the mass ratio of 7-azaindole to MFI zeolites was 6:7. (2) The 7-azaindole obtained from step (1) was The 7-azaindole-3-methanol was dissolved in dichloromethane, heated to 50 °C, KMnO4 was added (the molar ratio of 7-azaindole-3-methanol to KMnO4 was 12:15) and mixed thoroughly. The reaction mixture was stirred for 3 hours, then filtered, the filtrate was evaporated under reduced pressure, and the resulting solid was purified by recrystallization to give 7-azaindole-3-carboxylic acid in 94.3% yield and 99.3% purity. | | References | [1] Patent: CN107903261, 2018, A. Location in patent: Paragraph 0021-0031; 0035-0038; 0042-0045; 0049-0059 |
| | 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid Preparation Products And Raw materials |
|