m-PEG24-NHS ester manufacturers
- m-PEG24-NHS ester
-
-
2025-06-07
- CAS:2395839-96-8
- Min. Order: 500mg
- Purity: >95.00%
- Supply Ability: 500mg
|
| | m-PEG24-NHS ester Basic information |
| Product Name: | m-PEG24-NHS ester | | Synonyms: | m-PEG23-NHS ester;4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73-Tetracosaoxatetraheptacontanoic acid, 2,5-dioxo-1-pyrrolidinyl ester;mPEG23-CH2CH2COONHS;2,5-dioxopyrrolidin-1-yl 2,5,8,11,14,17,20,23,26,29,32,35,38,41,44,47,50,53,56,59,62,65,68,71-tetracosaoxatetraheptacontan-74-oate | | CAS: | 2395839-96-8 | | MF: | C54H103NO28 | | MW: | 1214.39 | | EINECS: | | | Product Categories: | | | Mol File: | 2395839-96-8.mol |  |
| | m-PEG24-NHS ester Chemical Properties |
| Boiling point | 967.4±75.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | form | Solid | | color | White to off-white | | InChIKey | VACCUKVGLYJBJU-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC |
| | m-PEG24-NHS ester Usage And Synthesis |
| Description | m-PEG24-NHS ester is a PEG linker containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | m-PEG24-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | m-PEG24-NHS ester Preparation Products And Raw materials |
|