| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
- MPEG3-NHS
-
-
2026-07-29
- CAS:622405-78-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000kgs
- m-PEG4-NHS ester
-
-
2025-06-07
- CAS:622405-78-1
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | MPEG3-NHS Basic information |
| Product Name: | MPEG3-NHS | | Synonyms: | MPEG3-NHS;Methyl-PEG4-NHS Ester;1-[(1-Oxo-4,7,10,13-tetraoxatetradec-1-yl)oxy]-2,5-pyrrolidinedione;4,7,10,13-Tetraoxatetradecanoic acid 2,5-dioxo-1-pyrrolidinyl ester;Methyl-PEG4-NHS Ester;m-PEG4-NHS ester;2,5-Dioxopyrrolidin-1-yl 2,5,8,11-tetraoxatetradecan-14-oate;mPEG3-CH2CH2COONHS Ester | | CAS: | 622405-78-1 | | MF: | C14H23NO8 | | MW: | 333.33 | | EINECS: | 200-258-5 | | Product Categories: | peg | | Mol File: | 622405-78-1.mol |  |
| | MPEG3-NHS Chemical Properties |
| Boiling point | 431.7±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DCM, DMF | | form | solid or viscous liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C14H23NO8/c1-19-6-7-21-10-11-22-9-8-20-5-4-14(18)23-15-12(16)2-3-13(15)17/h2-11H2,1H3 | | InChIKey | MAYFFZZPEREGBQ-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOC |
| HS Code | 2928.00.5000 | | Storage Class | 11 - Combustible Solids |
| | MPEG3-NHS Usage And Synthesis |
| Description | m-PEG4-NHS ester is a PEG linker containing an NHS ester. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The hydrophilic PEG spacer increases solubility in aqueous media. | | reaction suitability | reagent type: chemical modification reagent reagent type: cross-linking reagent reactivity: amine reactive |
| | MPEG3-NHS Preparation Products And Raw materials |
|