| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | D-Tyrosinol hydrochloride Basic information |
| | D-Tyrosinol hydrochloride Chemical Properties |
| Melting point | 167 °C | | alpha | 15 º (C=1, H2O 22 ºC) | | storage temp. | Inert atmosphere,2-8°C | | Optical Rotation | [α]22/D +18°, c = 1 in H2O | | Major Application | peptide synthesis | | InChI | 1S/C9H13NO2.ClH/c10-8(6-11)5-7-1-3-9(12)4-2-7;/h1-4,8,11-12H,5-6,10H2;1H/t8-;/m1./s1 | | InChIKey | PNGCRFWYSRUQTB-DDWIOCJRSA-N | | SMILES | Cl[H].N[C@@H](CO)Cc1ccc(O)cc1 | | CAS DataBase Reference | 40829-04-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29299000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | D-Tyrosinol hydrochloride Usage And Synthesis |
| Chemical Properties | white to off-white granular powder | | Uses | D-Tyrosinol hydrochloride is a useful reagent and reactant for organic reactions and synthesis. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | D-Tyrosinol hydrochloride Preparation Products And Raw materials |
|