|
|
| | Lipoic acid tromethamine salt Basic information |
| Product Name: | Lipoic acid tromethamine salt | | Synonyms: | R-(+)-ALA Tromethamine;1,2-dithiolane-3-valeric acid compound with 2-amino-2-(hydroxymethyl)propane-1,3-diol (1:1);1,2-dithiolane-3-valeric acid compound with 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-amino-2-(hydroxymethyl)propane-1,3-diol,5-(dithiolan-3-yl)pentanoic acid;Thioctate trometamol;2-amino-2-(hydroxymethyl)propane-1,3-diol,5-(dithiolan-3-yl)pentanoicaci;2-Amino-2-(hydroxymethyl)propane-1,3-diol 5-(1,2-dithiolan-3-yl)pentanoate;Lipoic acid tromethamine salt | | CAS: | 14358-90-8 | | MF: | C12H25NO5S2 | | MW: | 327.45 | | EINECS: | 238-329-9 | | Product Categories: | | | Mol File: | 14358-90-8.mol |  |
| | Lipoic acid tromethamine salt Chemical Properties |
| InChI | InChI=1S/C8H14O2S2.C4H11NO3/c9-8(10)4-2-1-3-7-5-6-11-12-7;5-4(1-6,2-7)3-8/h7H,1-6H2,(H,9,10);6-8H,1-3,5H2 | | InChIKey | CCTREOMTIFSZAU-UHFFFAOYSA-N | | SMILES | C(N)(CO)(CO)CO.C(C1SSCC1)CCCC(=O)O |
| | Lipoic acid tromethamine salt Usage And Synthesis |
| Uses | R-a-Lipoic Acid Tromethamine Salt is used in preparation of Piperazine Dithioctate for treatment of diabetic multiple neuritis, obesity. |
| | Lipoic acid tromethamine salt Preparation Products And Raw materials |
|