| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | Dihydrolipoic acid Basic information |
| Product Name: | Dihydrolipoic acid | | Synonyms: | (+/-)-DIHYDROLIPOIC ACID;DL-ALPHA-LIPOIC ACID REDUCED FORM;DL-ALPHA-LIPOIC ACID, DIHYDRO-;DL-6,8-THIOCTIC ACID, REDUCED;DL-6,8-THIOCTIC ACID REDUCED FORM;DL-1,2-DITHIOLANE-3-PENTANOIC ACID REDUCED FORM;LIPOIC ACID, REDUCED;THIOCYTIC ACID, DIHYDRO | | CAS: | 462-20-4 | | MF: | C8H16O2S2 | | MW: | 208.34 | | EINECS: | 610-288-5 | | Product Categories: | | | Mol File: | 462-20-4.mol |  |
| | Dihydrolipoic acid Chemical Properties |
| Melting point | 62 °C | | Boiling point | 161.5 °C(Press: 0.7 Torr) | | density | 1.132 g/cm3 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.5220-1.5260 | | storage temp. | +2C to +8C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | liquid | | pka | 4.74±0.10(Predicted) | | color | light yellow | | InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) | | InChIKey | IZFHEQBZOYJLPK-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCC(S)CCS | | LogP | 1.9 at 20℃ | | Surface tension | 53.6mN/m at 1.02g/L and 21℃ |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | RH0525000 | | HS Code | 2930.90.4950 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| | Dihydrolipoic acid Usage And Synthesis |
| Uses | γ-Lipoic Acid, is a metabolite of α-Lipoic Acid (L468730), which is a over-the-counter nutritional supplements, that has been used as antioxidant. It is also fat-metabolism stimulator, and thus used a "weight loss" and "energy" supplement. | | Definition | ChEBI: A thio-fatty acid that is reduced form of lipoic acid. A potent antioxidant shown to directly destroy superoxide, hydroperoxy and hydroxyl radicals; also has neuroprotective and anti-tumour effects. | | Biological Activity | Cell permeable: no', 'Primary Target Scavenges hypochlorous acid, peroxyl, superoxide, hydroxyl, and nitric oxide radicals', 'Product does not compete with ATP.', 'Reversible: no | | in vivo | Dihydrolipoic Acid (DHLA) treatment exerts preventive effects in LPS-induced sickness behavior rats. Dihydrolipoic Acid increases the expression of ERK, Nrf2, and HO-1 but decreases the ROS generation levels and reduces the expression of NLRP3, caspase-1, and IL-1β in LPS-induced sickness behavior rats. Dihydrolipoic Acid is a reduced form of α-lipoic acid (LA) that can decrease oxidative stress and act as a strong antioxidant[2]. Dihydrolipoic Acid treatment reverses the LPS-induced sickness behavior[2]. | Animal Model: | Adult male Sprague-Dawley (SD) rats (weight, 200-220g)[2] | | Dosage: | 15mg/kg, 30mg/kg, 60mg/kg | | Administration: | Injected intraperitoneally daily | | Result: | Treatment with 30mg/kg and 60mg/kg improved the body weight gain as compared to the LPS group. |
|
| | Dihydrolipoic acid Preparation Products And Raw materials |
|