| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3alpha,20alpha-Dihydroxy-5beta-pregnane 3-glucuronide Basic information |
| Product Name: | 3alpha,20alpha-Dihydroxy-5beta-pregnane 3-glucuronide | | Synonyms: | 5-BETA-PREGNAN-3-ALPHA, 20-ALPHA-DIOL 3-GLUCOSIDURONATE;5B-pregnane-3A-20A-diol glucuronide*crystalline;3α,20α-Dihydroxy-5β-pregnane 3-glucuronide;5β-Pregnane-3α,20α-diol glucuronide;(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(3R,5R,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-2-carboxylic acid;(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(3R,5R,8R,9S,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]tetrahydropyran-2-carboxylic acid;(3α,5β,20S)-20-Hydroxypregnan-3-yl β-D-Glucopyranosiduronic Acid;20α-Hydroxy-5β-pregnan-3α-yl β-D-Glucopyranosiduronic Acid | | CAS: | 1852-49-9 | | MF: | C27H44O8 | | MW: | 496.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1852-49-9.mol |  |
| | 3alpha,20alpha-Dihydroxy-5beta-pregnane 3-glucuronide Chemical Properties |
| Melting point | >94°C (dec.) | | Boiling point | 666.4±55.0 °C(Predicted) | | density | 1.30±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Methanol (Slightly) | | form | Solid | | pka | 2.82±0.70(Predicted) | | color | White to Pale Beige | | InChIKey | ZFFFJLDTCLJDHL-UHFFFAOYSA-N | | SMILES | CC(O)C1CCC2C3CCC4CC(CCC4(C)C3CCC12C)OC5OC(C(O)C(O)C5O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3alpha,20alpha-Dihydroxy-5beta-pregnane 3-glucuronide Usage And Synthesis |
| Uses | 3ALPHA,20ALPHA-DIHYDROXY-5BETA-PREGNANE 3-GLUCURONIDE is the glucuronide conjugate of Pregnanediol (P705130).3ALPHA,20ALPHA-DIHYDROXY-5BETA-PREGNANE 3-GLUCURONIDE can be used to monitor the reproductive status of dairy cows. 3ALPHA,20ALPHA-DIHYDROXY-5BETA-PREGNANE 3-GLUCURONIDE can be used (as an alternative to creatine) as a reference to adjust other hormonal markers in study of urinary hormonal profiles in the human menstrual cycle. | | Uses | Pregnanediol 3α-O-β-D-Glucuronide is the glucuronide conjugate of Pregnanediol (P705130). Levels of Pregnanediol 3α-O-β-D-Glucuronide can be used to monitor the reproductive status of dairy cows. 3α-O-β-D-Glucuronide can be used (as an alternative to creatine) as a reference to adjust other hormonal markers in study of urinary hormonal profiles in the human menstrual cycle. | | Definition | ChEBI: Pregnanediol-3-glucuronide is a steroid glucosiduronic acid. | | General Description | 5β-Pregnane-3α,20α-diol glucuronide is a progesterone metabolite predominant in urine, during pregnancy. Presence of 5β-Pregnane-3α,20α-diol glucuronide in the urine indicates pregnancy, but it might also account for pseudopregnancy. It is useful in predicting the delivery time/end of pseudopregnancy. | | IC 50 | Human Endogenous Metabolite |
| | 3alpha,20alpha-Dihydroxy-5beta-pregnane 3-glucuronide Preparation Products And Raw materials |
|