| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | DL-Phenylalanine-15N Basic information |
| | DL-Phenylalanine-15N Chemical Properties |
| Melting point | 266-267 °C (dec.) (lit.) | | form | solid | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/i10+1 | | InChIKey | COLNVLDHVKWLRT-DETAZLGJSA-N | | SMILES | [15NH2]C(Cc1ccccc1)C(O)=O | | CAS Number Unlabeled | 150-30-1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-Phenylalanine-15N Usage And Synthesis |
| Uses | DL-3-Phenylalanine-15N is the 15N labeled DL-3-Phenylalanine[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | DL-Phenylalanine-15N Preparation Products And Raw materials |
|