| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
|
| | 4-Nitro-3-phenyl-L-alanine Basic information |
| | 4-Nitro-3-phenyl-L-alanine Chemical Properties |
| Melting point | 236-239°C (dec.) | | Boiling point | 414.1±35.0 °C(Predicted) | | density | 1.408±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 2.12±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C9H10N2O4/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m0/s1 | | InChIKey | GTVVZTAFGPQSPC-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C([N+]([O-])=O)C=C1)N | | CAS DataBase Reference | 949-99-5(CAS DataBase Reference) |
| | 4-Nitro-3-phenyl-L-alanine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 4-Nitro-L-phenylalanine is used in the studies on the rational manipulation of protein structures for the expansion of the genetic code with non natural amino acids into protein via in vitro translation. | | Synthesis | General steps:
1. dissolve L-phenylalanine (16.5 g, 100 mmol) in 85% sulfuric acid (50 ml).
2. under stirring conditions, add slowly and dropwise a pre-prepared and cooled to room temperature acid mixture of concentrated nitric acid and concentrated sulfuric acid (1.4:1.1 by volume).
3. Stir the reaction mixture continuously for 5 hours at room temperature.
4. The pH of the reaction solution was adjusted to 2-3 using 40% sodium hydroxide solution, at which time a large amount of precipitate was formed.
5. Collect the precipitate by filtration and wash with deionized water until the filtrate is neutral. 6.
6. Dry the precipitate under reduced pressure to obtain 4-nitro-L-phenylalanine (20 g, yield 95.2%). | | References | [1] Bioorganic and Medicinal Chemistry, 2009, vol. 17, # 8, p. 3118 - 3125
[2] Patent: US2009/247470, 2009, A1. Location in patent: Page/Page column 12
[3] Bioorganic and Medicinal Chemistry, 2011, vol. 19, # 18, p. 5352 - 5360
[4] Russian Journal of Organic Chemistry, 2016, vol. 52, # 11, p. 1681 - 1685
[5] Zh. Org. Khim., 2016, vol. 52, # 11, p. 1686 - 1690,5 |
| | 4-Nitro-3-phenyl-L-alanine Preparation Products And Raw materials |
|