- Fmoc-D-Leu-OH
-
- $0.00 / 25Kg/Drum
-
2026-02-13
- CAS:114360-54-2
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- Fmoc-D-Leu-OH
-
- $0.00/ kg
-
2026-02-02
- CAS:114360-54-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-D-Leu-OH
-
- $0.00 / 25kg
-
2025-11-19
- CAS:114360-54-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000kg
|
| | Fmoc-D-leucine Basic information |
| | Fmoc-D-leucine Chemical Properties |
| Melting point | 155°C | | Boiling point | 559.8±33.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | refractive index | 25 ° (C=1, DMF) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.91±0.21(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | Consistent with structure | | Water Solubility | Insoluble in water. | | Major Application | peptide synthesis | | InChI | InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1 | | InChIKey | CBPJQFCAFFNICX-LJQANCHMSA-N | | SMILES | C(O)(=O)[C@@H](CC(C)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 114360-54-2(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29224999 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-D-leucine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | A convergent synthesis of the proposed structure of (+)-pestalazine B has been achieved in 4 steps using the N-alkylation of an unprotected tryptophan diketopiperazine with a 3a-bromopyrrolidinoindoline where the condensation between L-tryptophan methyl ester and N-Fmoc-D-leucine in the presence of EDC as coupling agent afforded the corresponding L-Trp-D-Leu dipeptide. | | Definition | ChEBI: Fmoc-D-Leu-OH is a leucine derivative. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-D-leucine Preparation Products And Raw materials |
|