4-Methyl-3-nitrobenzene-1-sulfonyl chloride manufacturers
|
| | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride Basic information |
| | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride Chemical Properties |
| Melting point | 30-34 °C (lit.) | | Boiling point | 152-154°C 1mm | | density | 1.528±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow to Green | | Sensitive | Moisture Sensitive | | BRN | 2696481 | | InChI | InChI=1S/C7H6ClNO4S/c1-5-2-3-6(14(8,12)13)4-7(5)9(10)11/h2-4H,1H3 | | InChIKey | OQFYBGANSUNUAO-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=C(C)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 616-83-1(CAS DataBase Reference) |
| Hazard Codes | C,Xi | | Risk Statements | 34-29-14 | | Safety Statements | 26-36/37/39-45-8-30-22 | | RIDADR | UN 3261 8/PG 3 | | WGK Germany | 3 | | HS Code | 2904.99.4700 | | HazardClass | 8 | | PackingGroup | II | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride Usage And Synthesis |
| | 4-Methyl-3-nitrobenzene-1-sulfonyl chloride Preparation Products And Raw materials |
|