| Company Name: |
Nanjing XiZe Biotechnology CO., Ltd. Gold
|
| Tel: |
025-66023220 15250997978 |
| Email: |
1511893459@qq.com |
| Products Intro: |
Product Name:7-Bromo Epinastine
CAS:1217052-16-8
Purity:95% HPLC Package:10mg;25mg;50mg;100mg;250mg;500mg;1g
|
|
| | 7-Bromo Epinastine Basic information |
| Product Name: | 7-Bromo Epinastine | | Synonyms: | 7-Bromo Epinastine;Epinastine IMpurity B HBr;3-AMino-7-broMo-9,13b-dihydro-1H-dibenz[c,f]iMidazo[1,5-a]azepine;7-BroMo-9,13b-dihydro-1H-dibenz[c,f]iMidazo[1,5-a]azepin-3-aMine;Epinastine EP Impurity B (7-Bromo Epinastine);Epinastine EP Impurity B HBr (7-Bromo Epinastine HBr);Epinastine EP Impurity B;Epinastine Impurity 2(Epinastine EP Impurity B) | | CAS: | 1217052-16-8 | | MF: | C16H14BrN3 | | MW: | 328.21 | | EINECS: | | | Product Categories: | Amines;Drug Analogues;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Amines, Drug Analogues, Heterocycles, Pharmaceuticals, Intermediates & Fine Chemicals | | Mol File: | 1217052-16-8.mol |  |
| | 7-Bromo Epinastine Chemical Properties |
| InChI | InChI=1S/C16H14BrN3/c17-12-5-6-14-11(8-12)7-10-3-1-2-4-13(10)15-9-19-16(18)20(14)15/h1-6,8,15H,7,9H2,(H2,18,19) | | InChIKey | HQFMNGNBQOQKRX-UHFFFAOYSA-N | | SMILES | N12C(N)=NCC1C1=CC=CC=C1CC1=CC(Br)=CC=C12 |
| | 7-Bromo Epinastine Usage And Synthesis |
| | 7-Bromo Epinastine Preparation Products And Raw materials |
|