|
|
| | Epinastine hydrochloride Basic information |
| Product Name: | Epinastine hydrochloride | | Synonyms: | f)imidazo(1,5-a)azepin-3-amine,9,13b-dihydro-ih-dibenz(hydrochloride;EPINASTIN HCL;3-AMINO-9,13B-DIHYDRO-1H-DIBENZ[C,F]IMIDAZO[1,5-A]AZEPINE HYDROCHLORIDE;WAL-801CL;9,13b-Dihydro-1H-Dibenz[c,f]imidazo[1,5-α]azepin-3-amine Hydrochloride;Alesion;Elestat;3-Amino-9,13b-dihydro-1H-dibenzo[c,f]imidazo[1,5-a]azepine·hydrochloride | | CAS: | 108929-04-0 | | MF: | C16H16ClN3 | | MW: | 285.77 | | EINECS: | 629-843-8 | | Product Categories: | Inhibitors;Heterocyclic Compounds;Bases & Related Reagents;Heterocycles;Intermediates & Fine Chemicals;Nucleotides;Pharmaceuticals;Antihistaminic | | Mol File: | 108929-04-0.mol |  |
| | Epinastine hydrochloride Chemical Properties |
| Melting point | 273-275°C | | storage temp. | 2-8°C | | solubility | H2O: soluble38mg/mL | | form | solid | | color | white | | InChI | 1S/C16H15N3.ClH/c17-16-18-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)19(15)16;/h1-8,15H,9-10H2,(H2,17,18);1H | | InChIKey | VKXSGUIOOQPGAF-UHFFFAOYSA-N | | SMILES | Cl[H].NC1=NCC2N1c3ccccc3Cc4ccccc24 |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | HO4360000 | | HS Code | 2933992600 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Toxicity | LD50 in male, female rats (mg/kg): 314, 192 orally; 17, 22 i.v. (Nishikawa) |
| | Epinastine hydrochloride Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A tetracyclic, non-sedating histamine H1 receptor antagonist. Antihistaminic. | | Biochem/physiol Actions | Epinastine hydrochloride is a non-sedating H1 histamine receptor antagonist. |
| | Epinastine hydrochloride Preparation Products And Raw materials |
|