|
|
| | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt Basic information |
| Product Name: | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt | | Synonyms: | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt;L(+)-N-(P-Methylamino Benzoyl)glutamate zinc;zinc,(2S)-2-[[4-(methylamino)benzoyl]amino]pentanedioate;JACS-66104-81-2;N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt USP/EP/BP;Zinc(II) (S)-2-(4-(methylamino)benzamido)pentanedioate;Zinc p-methylaminobenzoyl-l-glutamate;p-Methylaminobenzoyl-L-glutamic Acid Zinc | | CAS: | 66104-81-2 | | MF: | C13H14N2O5Zn | | MW: | 343.66 | | EINECS: | 1533716-785-6 | | Product Categories: | | | Mol File: | 66104-81-2.mol | ![N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt Structure](CAS2/GIF/66104-81-2.gif) |
| | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt Chemical Properties |
| InChI | InChI=1S/C13H16N2O5.Zn/c1-14-9-4-2-8(3-5-9)12(18)15-10(13(19)20)6-7-11(16)17;/h2-5,10,14H,6-7H2,1H3,(H,15,18)(H,16,17)(H,19,20);/q;+2/p-2 | | InChIKey | HKSAKGRLQPUPIZ-UHFFFAOYSA-L | | SMILES | C(C1C([O-][Zn+2]O=C(C2C=CC(NC)=CC=2)N1)=O)CC(=O)[O-] |
| | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt Usage And Synthesis |
| Uses | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt is used as a key intermediate in the synthesis of anti-folic acid agents such as methotrexate, and it has also been studied as an active ingredient with anti-inflammatory effects. | | Agricultural Uses | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt is used as a
herbicide for the purpose of controlling and eliminating unwanted plant
growth. It is particularly effective in targeting broadleaf and grassy
weeds in various crops, such as soybeans, corn, and wheat. The
application reason is its ability to disrupt the nitrogen metabolism in
plants, causing their death and thus preventing competition for
resources with the desired crops. |
| | N-[4-(Methylamino)benzoyl]-L-glutamic acid zinc salt Preparation Products And Raw materials |
|