- Tokinolide B
-
- $469.00
-
2026-07-15
- CAS:112966-16-2
- Purity: 98.64%
- Supply Ability: 10g
- Tokinolide B
-
- $9.80
-
2020-02-11
- CAS:112966-16-2
- Min. Order: 1g
- Purity: >98%
- Supply Ability: 20 tons
|
| | Tokinolide B Basic information |
| Product Name: | Tokinolide B | | Synonyms: | Tokinolide B;(3'Z)-(3S,8R,3a'S,6'R)-3,3a':8,6'-Diligustilide;[(3'Z)-(3S,8R,3A'S,6'R)-3,3A';(3'Z)-(3S;3A':8;6'R)-3;Spiro[3H-3a,6-ethanoisobenzofuran-4(1H),1'(3'H)-isobenzofuran]-1,3'-dione,3-butylidene-5,6,6',7'-tetrahydro-5-propyl-, (1'S,3Z,3aS,5R,6R)- | | CAS: | 112966-16-2 | | MF: | C24H28O4 | | MW: | 380.48 | | EINECS: | | | Product Categories: | | | Mol File: | 112966-16-2.mol |  |
| | Tokinolide B Chemical Properties |
| Boiling point | 644.2±55.0 °C(Predicted) | | density | 1.23±0.1 g/cm3(Predicted) | | storage temp. | -20°C, protect from light | | solubility | Soluble in DMSO | | form | Solid | | color | White to off-white | | InChIKey | DZMFTLLDUYBHLI-MUSNRYMWSA-N | | SMILES | C1(=O)C2[C@@]3(CC[C@]([H])(C=2)[C@@H](CCC)[C@@]23C3=C(C=CCC3)C(=O)O2)/C(=C/CCC)/O1 |
| | Tokinolide B Usage And Synthesis |
| Uses | Tokinolide B is isolated from the rhizomes of Ligusticum porter[1]. | | References | [1] León A, et al. Phthalides and other constituents from Ligusticum porteri; sedative and spasmolytic activities of some natural products and derivatives. Nat Prod Res. 2011 Aug;25(13):1234-42. DOI:10.1080/14786419.2010.534735 |
| | Tokinolide B Preparation Products And Raw materials |
|