| Company Name: |
TCI Europe |
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
|
| | 3-Bromo-3'-chloro-1,1'-biphenyl Basic information |
| Product Name: | 3-Bromo-3'-chloro-1,1'-biphenyl | | Synonyms: | 3-bromo-3'-chloro-1,1'-biphenyl;1,1'-Biphenyl, 3-bromo-3'-chloro-;9H-Carbazole, 3,6-dibromo-9-(2-naphthalenyl)-;3'-Chloro-3-bromo biphenyl;3,3'-CBBP;3-broMo-3-chloro-biphenyl
CAS：844856-42-4;C12H9BrCl 3-broMo-3-chloro-biphenyl 844856-42-4;3-Bromo-3’-chlorobiphenyl | | CAS: | 844856-42-4 | | MF: | C12H8BrCl | | MW: | 267.55 | | EINECS: | | | Product Categories: | | | Mol File: | 844856-42-4.mol |  |
| | 3-Bromo-3'-chloro-1,1'-biphenyl Chemical Properties |
| Melting point | 41 °C | | Boiling point | 331.7±17.0 °C(Predicted) | | density | 1.463±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C12H8BrCl/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H | | InChIKey | XDPLWYUXKVCBFV-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC(Cl)=C2)=CC=CC(Br)=C1 |
| | 3-Bromo-3'-chloro-1,1'-biphenyl Usage And Synthesis |
| Uses | 3-Bromo-3'-chloro-1,1'-biphenyl could be used to synthesis 4-[3'-(2-triphenylenyl)[1,1'-biphenyl]-3-yl]- and 4-(3′-Chloro[1,1′-biphenyl]-3-yl)dibenzothiophene,Dibenzothiophene. |
| | 3-Bromo-3'-chloro-1,1'-biphenyl Preparation Products And Raw materials |
|