| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-(3,5-Dinitrobenzoyl)-DL-leucine Basic information |
| | N-(3,5-Dinitrobenzoyl)-DL-leucine Chemical Properties |
| Melting point | 200-202 °C (lit.) | | Boiling point | 515.7±50.0 °C(Predicted) | | density | 1.405±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 3.77±0.40(Predicted) | | form | solid | | Major Application | peptide synthesis | | InChI | 1S/C13H15N3O7/c1-7(2)3-11(13(18)19)14-12(17)8-4-9(15(20)21)6-10(5-8)16(22)23/h4-7,11H,3H2,1-2H3,(H,14,17)(H,18,19) | | InChIKey | DIOBIOPCRMWGAT-UHFFFAOYSA-N | | SMILES | CC(C)CC(NC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-(3,5-Dinitrobenzoyl)-DL-leucine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | N-(3,5-Dinitrobenzoyl)-DL-leucine Preparation Products And Raw materials |
|