- N-BENZOYL-DL-ALANINE
-
- $8.80 / 1KG
-
2019-07-10
- CAS:1205-02-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | N-BENZOYL-DL-ALANINE Basic information |
| Product Name: | N-BENZOYL-DL-ALANINE | | Synonyms: | 2-(BENZOYLAMINO)PROPANOIC ACID;BENZOYL-DL-ALANINE;DL-N-BENZOYLALANINE;BZ-DL-ALA-OH;IFLAB-BB F1924-0021;Benzoylalanine;DL-N-BENZOYL-ALPHA-ALANINE;DL-Benzoylalanine | | CAS: | 1205-02-3 | | MF: | C10H11NO3 | | MW: | 193.2 | | EINECS: | 214-879-5 | | Product Categories: | | | Mol File: | 1205-02-3.mol |  |
| | N-BENZOYL-DL-ALANINE Chemical Properties |
| Melting point | 165-167°C | | Boiling point | 329.41°C (rough estimate) | | density | 1.2307 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.86±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | Very slightly soluble in water. | | BRN | 3201778 | | InChI | InChI=1S/C10H11NO3/c1-7(10(13)14)11-9(12)8-5-3-2-4-6-8/h2-7H,1H3,(H,11,12)(H,13,14)/t7-/m0/s1 | | InChIKey | UAQVHNZEONHPQG-ZETCQYMHSA-N | | SMILES | C(O)(=O)[C@H](C)NC(=O)C1=CC=CC=C1 | | CAS DataBase Reference | 1205-02-3(CAS DataBase Reference) | | EPA Substance Registry System | Alanine, N-benzoyl- (1205-02-3) |
| WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 2924297099 |
| | N-BENZOYL-DL-ALANINE Usage And Synthesis |
| Uses | N-Benzoyl-DL-alanine is used as pharmaceutical intermediate. | | Definition | ChEBI: An N-acylamino acid that is the N-benzoyl derivative of alanine. | | Synthesis Reference(s) | Tetrahedron Letters, 17, p. 2205, 1976 DOI: 10.1016/0040-4039(76)80029-9 |
| | N-BENZOYL-DL-ALANINE Preparation Products And Raw materials |
|