| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane Basic information |
| Product Name: | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane | | Synonyms: | TPDMDS;1-methyl-N-(methyldiphenylsilyl)-1,1-diphenylsilylamine;1 3-DIMETHYL-1 1 3 3-TETRAPHENYL- &;1,3-DIMETHYL-1,1,3,3-TETRAPHENYLDISILAZANE 97%;1,1,3,3-TETRAPHENYL-1,3-DIMETHYLDISILAZANE;1,1,3,3-TETRAPHENYLDIMETHYLDISILAZANE;1,1,3,3-Tetraphenyl-1,3-dimethylpropanedisilazane;1,3-Dimethyl-1,1,3,3-tetraphenylpropanedisilazane | | CAS: | 7453-26-1 | | MF: | C26H27NSi2 | | MW: | 409.67 | | EINECS: | 231-227-5 | | Product Categories: | | | Mol File: | 7453-26-1.mol |  |
| | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane Chemical Properties |
| Melting point | 87-89 °C (lit.)
87-89 °C | | Boiling point | 210-220 °C (0.5 mmHg) | | density | 1.07±0.1 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 5.56±0.70(Predicted) | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | BRN | 2952534 | | InChI | 1S/C26H27NSi2/c1-28(23-15-7-3-8-16-23,24-17-9-4-10-18-24)27-29(2,25-19-11-5-12-20-25)26-21-13-6-14-22-26/h3-22,27H,1-2H3 | | InChIKey | YFONAHAKNVIHPT-UHFFFAOYSA-N | | SMILES | C[Si](N[Si](C)(c1ccccc1)c2ccccc2)(c3ccccc3)c4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10 | | TSCA | Yes | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane Usage And Synthesis |
| Uses | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane is a silylating reagent, used for the hydrophobization of glass or silica surfaces. | | General Description | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane is a silylating reagent, used for the hydrophobization of glass or silica surfaces. |
| | 1,3-Dimethyl-1,1,3,3-tetraphenyldisilazane Preparation Products And Raw materials |
|