- Ruphos Pd G4
-
- $2.00
-
2026-08-25
- CAS:1599466-85-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | RuPhos Palladacycle Gen. 4 Basic information | | Appearence |
| Product Name: | RuPhos Palladacycle Gen. 4 | | Synonyms: | Methanesulfonato(2-dicyclohexylphosphino-2',6'-di-i-propoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II), min;Methanesulfonato(2-dicyclohexylphosphino-2',6'-di-i-propoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);RUPHOS PALLADACYCLE GEN. 4;Methanesulfonato(2-dicyclohexylphosphino-2,6-di-i-propoxy-1,1-biphenyl)(2-methylamino-1,1-biphenyl-2-yl)palladium(II),98% RuPhos Palladacycle Gen.4;Methanesulfonato(2-dicyclohexylphosphino-2',6'-di-i-propoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),RuPhos Palladacycle Gen.4;Methanesulfonato(2-Dicyclohexylphosphino-2',6'-diisopropoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);METHANESULFONATO(2-DICYCLOHEXYLPHOSPHINO-2',6'-DI-I-PROPOXY-1,1'-BIPHENYL)(2'-METHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II),MIN.98%[RUPHOSPALLADACYCLEGEN.4];Methanesulfonato(2-dicyclohexylphosphino-2',6'-di-i-propoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II),98% | | CAS: | 1599466-85-9 | | MF: | C44H58NO5PPdS | | MW: | 850.39 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1599466-85-9.mol |  |
| | RuPhos Palladacycle Gen. 4 Chemical Properties |
| Melting point | 240 °C | | form | Powder | | color | off-white to tan | | InChIKey | VPDSTBACNFQYGF-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC=CC=1OC(C)C)OC(C)C)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | RuPhos Palladacycle Gen. 4 Usage And Synthesis |
| Appearence |
White powder
| | Uses | A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. | | Reactions | Catalyst for the Buchwald-Hartwig Cross-Coupling Reaction
 | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | RuPhos Palladacycle Gen. 4 Preparation Products And Raw materials |
|