|
|
| | SPhos Palladacycle Gen. 4 Basic information | | Reaction |
| Product Name: | SPhos Palladacycle Gen. 4 | | Synonyms: | Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct min;[SPHOS PALLADACYCLE GEN. 4];Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct;METHANESULFONATO(2-DICYCLOHEXYLPHOSPHINO-2',6'-DIMETHOXY-1,1'-BIPHENYL)(2'-METHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II)DICHLOROMETHANEADDUCTMIN.98%[SPHOSPALLADACYCLEGEN.4];Methanesulfonato(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct,[SPhos Palladacycle Gen. 4];Methanesulfonato(2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II);Methanesulfonato(2-Dicyclohexylphosphino-2',6'-dimethoxybiphenyl)(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) / SPhos Pd G4 | | CAS: | 1599466-87-1 | | MF: | C40H50NO5PPdS | | MW: | 794.3 | | EINECS: | | | Product Categories: | Buchwald Ligands&Precatalysts;Buchwald Precatalysts Series;Pd | | Mol File: | 1599466-87-1.mol |  |
| | SPhos Palladacycle Gen. 4 Chemical Properties |
| storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Powder | | color | off-white to tan | | InChIKey | BELRILURKPSACB-UHFFFAOYSA-N | | SMILES | P(C1CCCCC1)(C1CCCCC1)(C1C=CC=CC=1C1C(=CC=CC=1OC)OC)[Pd+2]1(N(C2=CC=CC=C2C2=CC=CC=[C-]12)C)[O-]S(=O)(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | SPhos Palladacycle Gen. 4 Usage And Synthesis |
| Reaction | Alternative Catalyst for the Suzuki-Miyaura Cross-Coupling reaction.
| | Uses | SPhos Pd G4 is used as a versatile 4th generation palladium precatalyst developed by Buchwald group. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | SPhos Palladacycle Gen. 4 Preparation Products And Raw materials |
|