| Company Name: |
Shaanxi Didu New Materials Co. Ltd
|
| Tel: |
+86-86-17392712779 +86-13289823923 |
| Email: |
1090@dideu.com |
| Products Intro: |
Product Name:Formalin;phytane CAS:638-36-8 Purity:0.99 Package:25KG,200L
|
|
| | PHYTANE Basic information |
| Product Name: | PHYTANE | | Synonyms: | PHYTANE;tetrahydroneophytadiene;PHYTANE, STANDARD FOR GC;2,6,10,14-Tetramethylhexdecane;2,6,10,15-tetramethylhexadecane;HEXADECANE,2,6,10,14-TETRAMETHYL-,ORISOMER;2,6,10,14,18-Tetramethylhexadecane;High purity CAS 638-36-8 PHYTANE in stock | | CAS: | 638-36-8 | | MF: | C20H42 | | MW: | 282.55 | | EINECS: | 211-332-2 | | Product Categories: | | | Mol File: | 638-36-8.mol |  |
| | PHYTANE Chemical Properties |
| Boiling point | 69-71 °C0.001 mm Hg(lit.) | | density | 0.791 g/mL at 20 °C(lit.) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Hexane (Slightly) | | form | Liquid | | color | Clear Colorless | | BRN | 1744639 | | Major Application | environmental food and beverages | | InChI | 1S/C20H42/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h17-20H,7-16H2,1-6H3 | | InChIKey | GGYKPYDKXLHNTI-UHFFFAOYSA-N | | SMILES | CCC(C)CCCC(C)CCCC(C)CCCC(C)C | | EPA Substance Registry System | Phytane (638-36-8) |
| | PHYTANE Usage And Synthesis |
| Uses | Phytane is a useful intermediate, which is involved in the manufacturing and analysis of various compounds. Phytane has recently been used in the development of a stable and environmental-friendly lubricating oil. By determining the ration of !3C to 12C in phytane isolated from ocean sediments researchers in the Netherlands have been able to quantify CO2 levels reaching back to the Cambrian period when animals emerged on the earth. | | Definition | ChEBI: Phytane is a diterpene. |
| | PHYTANE Preparation Products And Raw materials |
|