4,5-Diaminofluorescein manufacturers
- DAF-2
-
-
2025-06-07
- CAS:205391-01-1
- Min. Order: 5mg
- Purity: >99.00%
- Supply Ability: 5mg
|
| | 4,5-Diaminofluorescein Basic information |
| Product Name: | 4,5-Diaminofluorescein | | Synonyms: | 2-(3,6-DIHYDROXY-9H-XANTHEN-9-YL)-4,5-DIAMINO-BENZOIC ACID;5,6-DIAMINOFLUORESCEIN;4,5-Diaminofluorescein, DAF-2;4,5-Diaminofluorescein-Isopropanol adduct (1:2);5-Diaminofluorescein;DAF-2;4;5-DIAMINOFLUORESCEIN;Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 5,6-diamino-3',6'-dihydroxy-;5,6-Diamino-3',6'-dihydroxy-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one | | CAS: | 205391-01-1 | | MF: | C20H14N2O5 | | MW: | 362.34 | | EINECS: | | | Product Categories: | | | Mol File: | 205391-01-1.mol |  |
| | 4,5-Diaminofluorescein Chemical Properties |
| Boiling point | 760.832±60.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.696±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 9.319±0.20(predicted) | | color | Brown to black | | InChI | 1S/C20H14N2O5/c21-15-7-11-14(8-16(15)22)20(27-19(11)25)12-3-1-9(23)5-17(12)26-18-6-10(24)2-4-13(18)20/h1-8,23-24H,21-22H2 | | InChIKey | LTYUPYUWXRTNFQ-UHFFFAOYSA-N | | SMILES | Nc1cc2c(cc1N)C(=O)OC32c4c(cc(cc4)O)Oc5c3ccc(c5)O |
| | 4,5-Diaminofluorescein Usage And Synthesis |
| Description | DAF-2 is a sensitive fluorescent indicator commonly used for the detection of nitric oxide (NO). It reacts with NO in the presence of oxygen to yield the highly fluorescent triazolofluorescein (DAF-2T). Fluorescence is monitored using excitation and emission wavelengths of 485 and 538 nM, respectively. At neutral pH the detection limit for NO is 2-5 nM. | | Uses | DAF-2 is highly sensitive reagent for NO detection and determination of nitric oxide synthase activity. | | Uses | Fluorescent detector of nitric oxide in culture medium, tissue sections and biopsy cells. | | References | [1] H KOJIMA. Development of a fluorescent indicator for nitric oxide based on the fluorescein chromophore.[J]. Chemical & pharmaceutical bulletin, 1998, 46 2: 373-375. DOI: 10.1248/cpb.46.373
[2] NAOKI NAKATSUBO. Direct evidence of nitric oxide production from bovine aortic endothelial cells using new fluorescence indicators: diaminofluoresceins[J]. FEBS Letters, 1998, 427 2: 263-266. DOI: 10.1016/s0014-5793(98)00440-2 |
| | 4,5-Diaminofluorescein Preparation Products And Raw materials |
|