| Company Name: |
MO-CHEM Gold |
| Tel: |
13851755987 |
| Email: |
dingdalei@mo-chem.com.cn |
4,5-Diaminofluorescein diacetate manufacturers
- DAF-2 DA
-
- $1237.00
-
2026-09-10
- CAS:205391-02-2
- Purity:
- Supply Ability: 10g
|
| | 4,5-Diaminofluorescein diacetate Basic information |
| Product Name: | 4,5-Diaminofluorescein diacetate | | Synonyms: | DAF-2 DA - CAS 205391-02-2 - Calbiochem;4,5-DIAMINOFLUORORESCEIN DIACETATE;5,6-DIAMINOFLUORESCEIN DIACETATE;2-(3,6-DIACETYLOXY-9H-XANTHEN-9-YL)-4,5-DIAMINO-BENZOIC ACID;DAF-2 DA;DAF-2 DA, CELL PERMEABLE;DAF-2 DIACETATE;5,6-Diaminofluorescein diacetat | | CAS: | 205391-02-2 | | MF: | C24H18N2O7 | | MW: | 446.41 | | EINECS: | | | Product Categories: | | | Mol File: | 205391-02-2.mol |  |
| | 4,5-Diaminofluorescein diacetate Chemical Properties |
| Boiling point | 719.0±60.0 °C(Predicted) | | density | 1.54±0.1 g/cm3(Predicted) | | Fp | 87 °C | | storage temp. | 2-8°C | | solubility | DMSO: <2mg/mL | | form | Pale yellow solution | | pka | 2.92±0.20(Predicted) | | color | white | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C24H18N2O7/c1-11(27)30-13-3-5-16-21(7-13)32-22-8-14(31-12(2)28)4-6-17(22)24(16)18-10-20(26)19(25)9-15(18)23(29)33-24/h3-10H,25-26H2,1-2H3 | | InChIKey | PTSUYDXEEKDBQU-UHFFFAOYSA-N | | SMILES | O=C1OC2(C3=C(OC4=C2C=CC(OC(C)=O)=C4)C=C(OC(C)=O)C=C3)C5=C1C=C(N)C(N)=C5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4,5-Diaminofluorescein diacetate Usage And Synthesis |
| Uses | Highly sensitive probe for the real time detection of NO in vivo, cell permeable. | | Uses | DAF-2 DA (cell permeable) is suitable for the fluorimetric detection of nitric oxide. | | Biological Activity | Primary Target
Used to measure real-time changes in NO levels |
| | 4,5-Diaminofluorescein diacetate Preparation Products And Raw materials |
|