|
|
| | 3,5-Dimethoxybenzyl alcohol Basic information |
| Product Name: | 3,5-Dimethoxybenzyl alcohol | | Synonyms: | Benzenemethanol, 3,5-dimethoxy-;3,5-DiMethoxybenzyl alcohol, 98% 5GR;3,5-Dimethoxybenzenemethanol;3,5-Dimethoxybenzyl alcohol 99%;3,5-Dimethoxybenzyl alcohol≥ 99% (HPLC);3,5-DIMETHOXYBENZYL ALCOHOL;(3,5-DIMETHOXYPHENYL)METHANOL;RARECHEM AL BD 0065 | | CAS: | 705-76-0 | | MF: | C9H12O3 | | MW: | 168.19 | | EINECS: | 211-888-6 | | Product Categories: | Aromatics;Intermediates;Miscellaneous Reagents;C9 to C30;Oxygen Compounds;Alcohols;Anisoles, Alkyloxy Compounds & Phenylacetates;Building Blocks for Dendrimers;Functional Materials;Benzhydrols, Benzyl & Special Alcohols;bc0001;1 | | Mol File: | 705-76-0.mol |  |
| | 3,5-Dimethoxybenzyl alcohol Chemical Properties |
| Melting point | 43-46 °C(lit.) | | Boiling point | 183-186°C 20mm | | density | 1.1322 (rough estimate) | | refractive index | 1.5470 (estimate) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 14.24±0.10(Predicted) | | form | Solid | | color | White to Off-White | | BRN | 1866305 | | InChI | InChI=1S/C9H12O3/c1-11-8-3-7(6-10)4-9(5-8)12-2/h3-5,10H,6H2,1-2H3 | | InChIKey | AUDBREYGQOXIFT-UHFFFAOYSA-N | | SMILES | C1(CO)=CC(OC)=CC(OC)=C1 | | LogP | 1.102 (est) | | CAS DataBase Reference | 705-76-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | HS Code | 29094990 | | Storage Class | 11 - Combustible Solids |
| | 3,5-Dimethoxybenzyl alcohol Usage And Synthesis |
| Description | 3,5-Dimethoxybenzyl alcohol (L1 OH) is an important pharmaceutical intermediate and also the starting material for the family of dendritic polymers LnOH (the integer n indicates the number of ‘branching’ layers). 3,5-Dimethoxybenzyl alcohol can be used as an organic synthesis raw material to prepare compounds such as 3,5-Dimethoxybenzonitrile, 3-hydroxy-5-methoxybenzaldehyde, and 5,7-Dimethoxyindan-1-one. | | Chemical Properties | white to yellow-beige crystalline solid | | Uses | 3,5-Dimethoxybenzyl Alcohol is used in the synthesis of Resveratrol (R150000). | | Uses | 3,5-Dimethoxybenzyl alcohol was used as starting material for the synthesis of dendrimeric compounds. | | Synthesis Reference(s) | Journal of the American Chemical Society, 70, p. 664, 1948 DOI: 10.1021/ja01182a068 | | General Description | 3,5-Dimethoxybenzyl alcohol is an important pharmaceutical intermediate. |
| | 3,5-Dimethoxybenzyl alcohol Preparation Products And Raw materials |
|