| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,2-Dichloro-4-fluorobenzene Basic information |
| Product Name: | 1,2-Dichloro-4-fluorobenzene | | Synonyms: | 3,4-DICHLOROFLUOROBENZENE;1,2-DICHLORO-4-FLUOROBENZENE;Benzene, 1,2-dichloro-4-fluoro-;3,4-dichloro-1-fluorobenzene;3,4-Dichlorofluorobenzene 99%;3,4-Dichlorofluorobenzene99%;3,4-Dichlorofluorobenzene 1,2-Dichloro-4-Fluorobenzene;1,2-Dichloro-4-fluorobenzene, 98+% | | CAS: | 1435-49-0 | | MF: | C6H3Cl2F | | MW: | 164.99 | | EINECS: | 215-858-3 | | Product Categories: | Fluorine series;Chlorine Compounds;Fluorine Compounds | | Mol File: | 1435-49-0.mol |  |
| | 1,2-Dichloro-4-fluorobenzene Chemical Properties |
| Melting point | −1 °C(lit.) | | Boiling point | 172 °C(lit.) | | density | 1.403 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.524(lit.) | | Fp | 148 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.403 | | BRN | 1861278 | | InChI | InChI=1S/C6H3Cl2F/c7-5-2-1-4(9)3-6(5)8/h1-3H | | InChIKey | QSDKXMVGRLVIQV-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 1435-49-0(CAS DataBase Reference) | | NIST Chemistry Reference | 1,2-Dichloro-4-fluorobenzene(1435-49-0) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-37/39-37 | | RIDADR | 1993 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | III | | HS Code | 29039990 |
| | 1,2-Dichloro-4-fluorobenzene Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 1,2-Dichloro-4-fluorobenzene is used as pharmaceutical, pesticide, and liquid crystal material intermediates. |
| | 1,2-Dichloro-4-fluorobenzene Preparation Products And Raw materials |
|