|
|
| | 1,3-Dichloro-4-fluorobenzene Basic information |
| | 1,3-Dichloro-4-fluorobenzene Chemical Properties |
| Melting point | -23 °C | | Boiling point | 172-174 °C(lit.) | | density | 1.409 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.525(lit.) | | Fp | 98 °F | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | Specific Gravity | 1.409 | | color | Colorless to Light yellow to Light orange | | Water Solubility | insoluble | | BRN | 2500791 | | InChI | InChI=1S/C6H3Cl2F/c7-4-1-2-6(9)5(8)3-4/h1-3H | | InChIKey | BDJZCCWUSOZUQG-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(Cl)C=C1Cl | | CAS DataBase Reference | 1435-48-9(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3-Dichloro-4-fluorobenzene(1435-48-9) |
| | 1,3-Dichloro-4-fluorobenzene Usage And Synthesis |
| Chemical Properties | Clear colourless to yellow liquid | | Uses | 1, 3-dichloro-4-fluorobenzene is a multifunctional chemical reagent. Its benzene ring structure formula contains fluorine and chlorine functional groups and can be used in various reaction systems. It is widely applied in the field of organic synthesis. | | Synthesis | The general procedure for the synthesis of 2,4-dichlorofluorobenzene from 3-chloro-4-fluoronitrobenzene is as follows: 240 g (1.37 mol) of 3-chloro-4-fluoronitrobenzene was added to a 250 ml four-necked flask and the temperature of the reaction system was raised to 170°C. The temperature of the reaction system was raised to 170°C. The reaction system was then purged with dry chlorine. Dry chlorine gas was slowly passed in the temperature range of 170 to 180 °C. The reaction process was carried out by distillation for 8 hours and the distillate was collected. The distillate was subsequently washed with water and then with alkali to a weakly basic pH. The organic phase was separated and purified by distillation, resulting in 207 g of 2,4-dichlorofluorobenzene with 99.8% purity and 91.7% yield. | | References | [1] Patent: CN102249881, 2016, B. Location in patent: Paragraph 0020; 0075-0076 [2] Recueil des Travaux Chimiques des Pays-Bas, 1932, vol. 51, p. 98,109 |
| | 1,3-Dichloro-4-fluorobenzene Preparation Products And Raw materials |
| Raw materials | Fluorobenzene-->4-Nitrobenzoyl chloride-->3-Chloro-4-fluoroaniline-->3-Chloro-4-fluoronitrobenzene-->2,4-Dinitrofluorobenzene-->5-Chloro-2-fluoronitrobenzene-->2,4-Dichloroaniline-->2,4-dichloroanilinium chloride | | Preparation Products | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-8-methoxy-4-oxoquinoline-3-carboxylic acid-->2,4-Dichloro-5-fluoro-3-methoxybenzoyl chloride-->2,4-DICHLORO-5-FLUORO-3-METHOXYBENZOIC ACID-->1-(2,4-Dichloro-5-fluoro-3-methoxyphenyl)ethanone-->3-BROMO-2,6-DICHLORO-5-FLUORO-1-METHOXYBENZENE-->Ciprofloxacin-->1-AMINO-2,4-DICHLORO-5-FLUORO-3-METHOXYBENZENE-->2,4-Dichloro-5-fluoro-3-methoxynitro-benzene-->Ciprofloxacin hydrochloride-->2,4-Dichloro-5-fluorobenzoic acid-->3-Bromo-2,4-dichloro-5-fluoronitrobenzene-->2,4-Dichloro-5-fluoroacetophenone-->2,4-Dichloro-5-fluoronitrobenzene-->2,6-Dichloro-3-fluoroacetophenone-->1-(2,6-Dichloro-3-fluorophenyl)ethanol |
|