| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5-Bromo-4,6-dichloropyrimidine Basic information |
| | 5-Bromo-4,6-dichloropyrimidine Chemical Properties |
| Melting point | 83-85 | | Boiling point | 294.6±35.0 °C(Predicted) | | density | 1.964±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | -5.72±0.26(Predicted) | | color | White | | InChI | InChI=1S/C4HBrCl2N2/c5-2-3(6)8-1-9-4(2)7/h1H | | InChIKey | BKLHHTTZTSYHBV-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(Br)C(Cl)=N1 | | CAS DataBase Reference | 68797-61-5(CAS DataBase Reference) | | EPA Substance Registry System | Pyrimidine, 5-bromo-4,6-dichloro- (68797-61-5) |
| Hazard Codes | Xi,T | | Risk Statements | 25-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN2923 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |
| | 5-Bromo-4,6-dichloropyrimidine Usage And Synthesis |
| Chemical Properties | White crystal |
| | 5-Bromo-4,6-dichloropyrimidine Preparation Products And Raw materials |
|