|
|
| | 3,5-DIBROMOBENZYL ALCOHOL Basic information |
| | 3,5-DIBROMOBENZYL ALCOHOL Chemical Properties |
| Melting point | 107-108°C | | Boiling point | 328℃ | | density | 1.960 | | Fp | 152℃ | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.98±0.10(Predicted) | | Appearance | Light brown to brown Solid | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H6Br2O/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 | | InChIKey | ZQNSHKZQTZSNTB-UHFFFAOYSA-N | | SMILES | C1(CO)=CC(Br)=CC(Br)=C1 | | CAS DataBase Reference | 145691-59-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 3,5-DIBROMOBENZYL ALCOHOL Usage And Synthesis |
| Uses | It is used in the synthesis of substituted benzylamines. | | Synthesis | Step 1: To a stirred solution of 3,5-dibromobenzoic acid (2 g, 7.168 mmol) in tetrahydrofuran (20 mL) was slowly added borane dimethyl sulfide (3.4 mL, 35.842 mmol, 5 eq.) at 0 °C. The reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, the mixture was cooled to 0 °C and the reaction was carefully quenched with methanol (appropriate amount). Subsequently, the reaction mixture was concentrated under reduced pressure to afford (3,5-dibromophenyl)methanol as an off-white solid (1.8 g, 94% yield). The product was characterized by 1H NMR (400 MHz, DMSO-d6): δ 4.47 (d, J = 6Hz, 2H), 5.39 (t, J = 6Hz, 1H), 7.49 (s, 2H), 7.65 (s, 1H). | | References | [1] Patent: WO2017/46739, 2017, A1. Location in patent: Page/Page column 60
[2] Patent: JP2005/120047, 2005, A. Location in patent: Page/Page column 165
[3] Synlett, 2002, # 2, p. 251 - 254
[4] European Journal of Medicinal Chemistry, 2011, vol. 46, # 9, p. 4227 - 4237 |
| | 3,5-DIBROMOBENZYL ALCOHOL Preparation Products And Raw materials |
|