|
|
| | P-CRESOL-D8 Basic information |
| | P-CRESOL-D8 Chemical Properties |
| Melting point | 32-34 °C(lit.) | | Boiling point | 202 °C(lit.) | | density | 1.126 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.537(lit.) | | Fp | 89 °C | | Major Application | environmental | | InChI | 1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3/i1D3,2D,3D,4D,5D/hD | | InChIKey | IWDCLRJOBJJRNH-IWRLGKISSA-N | | SMILES | [2H]Oc1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[2H] | | EPA Substance Registry System | 4-Methylphenol-d8 (190780-66-6) | | CAS Number Unlabeled | 106-44-5 |
| Hazard Codes | T | | Risk Statements | 24/25-34-23/24/25 | | Safety Statements | 36/37/39-45-26 | | RIDADR | UN 3455 6.1/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Chronic 2
Eye Dam. 1
Skin Corr. 1B |
| | P-CRESOL-D8 Usage And Synthesis |
| Uses | p-Cresol-d8 this compound is the labelled analog of a p-cresol (C781900) metabolite. |
| | P-CRESOL-D8 Preparation Products And Raw materials |
|