| Company Name: |
BOC Sciences Gold |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
2'-Deoxycytidine-5'-diphosphate trisodium salt manufacturers
|
| | 2'-Deoxycytidine-5'-diphosphate trisodium salt Basic information |
| | 2'-Deoxycytidine-5'-diphosphate trisodium salt Chemical Properties |
| Melting point | >179.0°C (dec.) | | storage temp. | -20°C | | solubility | Water | | form | Solid | | color | White | | Water Solubility | Soluble in water. | | InChI | 1S/C9H15N3O10P2.Na.H2O.H/c10-7-1-2-12(9(14)11-7)8-3-5(13)6(21-8)4-20-24(18,19)22-23(15,16)17;;;/h1-2,5-6,8,13H,3-4H2,(H,18,19)(H2,10,11,14)(H2,15,16,17);;1H2; | | InChIKey | MNOALMYIRLFAQW-UHFFFAOYSA-N | | SMILES | O.[Na].NC1=NC(=O)N(C=C1)C2CC(O)C(COP(O)(=O)OP(O)(O)=O)O2 |
| Hazard Codes | T | | Risk Statements | 23/24/25-36/37/38 | | Safety Statements | 22-26-36-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 6.1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2'-Deoxycytidine-5'-diphosphate trisodium salt Usage And Synthesis |
| Uses | A phosphorylated metabolite of the deoxyribonucleoside 2’-Deoxycytidine. A constituent of Deoxyribonucleic acid. | | Uses | 2′-Deoxycytidine 5′-diphosphate (dCDP) has been used as a substrate for nucleotide diphosphate kinase (NDPK) to produce 2′-deoxycytidine 5′-triphosphate (dCTP) in support of DNA biosynthesis and reverse transcription. |
| | 2'-Deoxycytidine-5'-diphosphate trisodium salt Preparation Products And Raw materials |
|