- Boc-L- Prolinal
-
- $1.10
-
2026-08-25
- CAS:69610-41-9
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 100KG
- N-BOC-L-Prolinal
-
-
2026-07-23
- CAS:69610-41-9
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kgs
- N-Boc-L-Prolinal
-
-
2024-11-26
- CAS:69610-41-9
- Min. Order: 1kg
- Purity: 98%GC
- Supply Ability: 200kg
|
| | N-BOC-L-Prolinal Basic information |
| | N-BOC-L-Prolinal Chemical Properties |
| Boiling point | 211 °C (lit.) | | alpha | -101 º (c=0.66 in chloroform) | | density | 1.063 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 135 °F | | storage temp. | -20°C | | form | liquid | | pka | -3.03±0.40(Predicted) | | color | Light brown | | Specific Gravity | 1.063 | | Optical Rotation | [α]20/D 101°, c = 0.66 in chloroform | | Water Solubility | Slightly soluble water. Soluble in chloroform. | | Sensitive | Air Sensitive | | Major Application | peptide synthesis | | InChI | 1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h7-8H,4-6H2,1-3H3/t8-/m0/s1 | | InChIKey | YDBPZCVWPFMBDH-QMMMGPOBSA-N | | SMILES | [H]C(=O)[C@@H]1CCCN1C(=O)OC(C)(C)C | | CAS DataBase Reference | 69610-41-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1989 | | WGK Germany | 3 | | HazardClass | IRRITANT | | PackingGroup | Ⅲ | | HS Code | 29339900 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | N-BOC-L-Prolinal Usage And Synthesis |
| Chemical Properties | clear light yellow viscous liquid | | Uses | Key building block for norsecurinine-type alkaloids and isaindigotidione carboskeleton.1,2 | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N-BOC-L-Prolinal Preparation Products And Raw materials |
|