|
|
| | 6-Bromo-2-pyridinecarbonitrile Basic information | | Application |
| | 6-Bromo-2-pyridinecarbonitrile Chemical Properties |
| Melting point | 100-104 °C | | Boiling point | 269.7±20.0 °C(Predicted) | | density | 1.72±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Low Melting Solid or Crystalline Powder | | pka | -4.76±0.10(Predicted) | | color | White to off-white | | InChI | InChI=1S/C6H3BrN2/c7-6-3-1-2-5(4-8)9-6/h1-3H | | InChIKey | HNEBPTAKURBYRM-UHFFFAOYSA-N | | SMILES | C1(C#N)=NC(Br)=CC=C1 | | CAS DataBase Reference | 122918-25-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-37/38-41-R41-R37/38-R22 | | Safety Statements | 26-39-S39-S26 | | RIDADR | UN3439 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | 6-Bromo-2-pyridinecarbonitrile Usage And Synthesis |
| Application | 2-Bromo-6-cyanopyridine is an organic synthesis intermediate and a pharmaceutical intermediate that can be used in laboratory research and development processes and chemical production processes. | | Description | 6-Bromo-2-pyridinecarbonitrile is a small molecule that can be used as a sensitizer for photovoltaic cells. It has been shown to have photocurrents in the visible region of the spectrum and strong luminescence properties. 6-Bromo-2-pyridinecarbonitrile is also an effective chromophore for use in solar cells and can be functionalized by means of pyrazolyl or triazolyl groups. This compound has been shown to bind to antibodies, which are proteins that are produced by the body's immune system to identify and neutralize foreign objects, including bacteria and viruses. The binding of 6-bromo-2-pyridinecarbonitrile with monoclonal antibodies provides a possible route for developing new biomolecules with antibacterial properties. |
| | 6-Bromo-2-pyridinecarbonitrile Preparation Products And Raw materials |
|