|
|
| | 6-Chloro-2-picolinic acid methyl ester Basic information |
| Product Name: | 6-Chloro-2-picolinic acid methyl ester | | Synonyms: | Methyl 6-Chloropyridine-2-carboxylate, 97+%;AKOS BBS-00004651;6-CHLOROPYRIDINE-2-CARBOXYLIC ACID METHYL ESTER;6-Chloro-2-pyridinecarboxylic acid methyl ester;6-Chloropicolinic acid methyl ester;2-Pyridinecarboxylic acid, 6-chloro-, methyl ester;methyl 2-(6-chloropyridin-2-yl)acetate;methyl (6-chloropyridin-2-yl)acetate | | CAS: | 6636-55-1 | | MF: | C7H6ClNO2 | | MW: | 171.58 | | EINECS: | 808-173-1 | | Product Categories: | Picolinic acid series | | Mol File: | 6636-55-1.mol |  |
| | 6-Chloro-2-picolinic acid methyl ester Chemical Properties |
| Melting point | 93-94° | | Boiling point | 275.8±20.0 °C(Predicted) | | density | 1.294±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | -1.03±0.10(Predicted) | | form | Solid | | color | Pale yellow | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C7H6ClNO2/c1-11-7(10)5-3-2-4-6(8)9-5/h2-4H,1H3 | | InChIKey | TWUXBVMXSBEKHA-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC(Cl)=CC=C1 |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 6-Chloro-2-picolinic acid methyl ester Usage And Synthesis |
| Uses | Methyl 6-chloropyridine-2-carboxylate was coupled with 2-(trimethylstannyl)pyridine to afford methyl 2,2-bipyridine-6-carboxylate. | | Synthesis Reference(s) | Synthetic Communications, 14, p. 77, 1984 DOI: 10.1080/00397918408060867 | | Synthesis | 6-Chloro-2-picolinic acid methyl ester is prepared by the reaction of methanol and 6-Chloropicolinic acid. The specific synthesis steps are as follows: Add thionyl chloride (3.7 ml, 50.8 mmol) to a solution of 6-chloropicolinic acid (4.0 g, 25.4 mmol) in methanol (85 ml) at 0 C. Stir the resultant solution for 15 minutes at 0 C, 0.5 hours at room temperature, and 6 hours at 50 C. Concentrate the reaction in vacuo and dilute with CHCl3 (150ml). Wash the organic solution with saturated aqueous sodium bicarbonate (3 x 100 ml), and brine (1 x 100 ml) and dry with sodium sulfate. Filtration and concentration afford methyl 6-chloropicolinate 4.38 g (100 percent) as a white solid. 1H NMR (CDCl3): δ 8.05 (m, 1H), 7.73 (m, 1H), 7.42 (m, 1H), 3.95 (s, 3H).
 | | References | [1] Patent: WO2004/26871, 2004, A1. Location in patent: Page 43 [2] Patent: WO2007/58482, 2007, A1. Location in patent: Page/Page column 47 [3] Patent: WO2013/102431, 2013, A1. Location in patent: Page/Page column 117 [4] Patent: WO2015/6592, 2015, A1. Location in patent: Page/Page column 52; 53 |
| | 6-Chloro-2-picolinic acid methyl ester Preparation Products And Raw materials |
|