|
|
| | COPPER(I) THIOPHENE-2-CARBOXYLATE Basic information |
| Product Name: | COPPER(I) THIOPHENE-2-CARBOXYLATE | | Synonyms: | Copper(I) thiophene-2-carboxylate, may contain approx. 20 wt.% Copper(I) oxide, 95%;Copper(I) thiophene-2-carboxylate,Cu (TC);Copper(I) thiophene-2-carboxylate, 95%, May contain approx. 20 wt.% Copper(I) oxide;Copper(I) thiophene-2-carboxylate, 90%, May contain approx. 20 wt.% Copper(I) oxide;Copper(Ⅰ) thiophene-2-carboxylate;(2-Thiophenecarboxylato)copper;2-Thiophenecarboxylic acid, copper complex;Cuprous 2-thiophenecarboxylate | | CAS: | 68986-76-5 | | MF: | C5H3CuO2S | | MW: | 190.69 | | EINECS: | 350-745-9 | | Product Categories: | Cu;Catalysts-Ligands | | Mol File: | 68986-76-5.mol |  |
| | COPPER(I) THIOPHENE-2-CARBOXYLATE Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Powder | | color | Red to brown | | Sensitive | Air & Light Sensitive | | Merck | 14,2521 | | Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 | | InChI | InChI=1S/C5H4O2S.Cu/c6-5(7)4-2-1-3-8-4;/h1-3H,(H,6,7);/q;+1/p-1 | | InChIKey | SFJMFSWCBVEHBA-UHFFFAOYSA-M | | SMILES | [Cu+].C1(C([O-])=O)SC=CC=1 |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-61 | | RIDADR | 3077 | | WGK Germany | 3 | | HazardClass | IRRITANT, AIR SENSITIVE, LIGHT SENSITIVE | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| | COPPER(I) THIOPHENE-2-CARBOXYLATE Usage And Synthesis |
| Chemical Properties | COPPER(I) THIOPHENE-2-CARBOXYLATE is Solid | | Uses | COPPER(I) THIOPHENE-2-CARBOXYLATE is used for studies of xenobiotic response safener derivatives, synthesis of functionalized BODIPY dye analogs, orthogonal cross-coupling reactions, preparation of parent borondipyrromethene system and Copper mediated cross-coupling. | | Uses | Reactant or reagent involved in:
Studies of xenobiotic response to herbicide safener derivatives; Synthesis of functionalized BODIPY dye analogs; Orthogonal cross-coupling reactions; Preparation of parent borondipyrromethene system; Copper mediated cross-coupling | | Uses | Mediator in intermolecular cross-coupling reactions, asymmetric 1,4-additions, and allylation reactions. | | reaction suitability | core: copper reaction type: C-C Bond Formation reagent type: catalyst |
| | COPPER(I) THIOPHENE-2-CARBOXYLATE Preparation Products And Raw materials |
|