|
|
| | 2,3,6-TRIFLUOROBENZOIC ACID Basic information |
| Product Name: | 2,3,6-TRIFLUOROBENZOIC ACID | | Synonyms: | RARECHEM AL BO 0267;2,3,6-TRIFLUOROBENZOIC ACID;2,3,6-Trifluorobenzoic acid 98%;2,3,6-Trifluorobenzoicacid98%;2,3,6-Trilfuorobenzoic acid;2,5,6-Trifluorobenzoic acid;2,3,6-Trifluorobenzo;2,3,6-TrifL | | CAS: | 2358-29-4 | | MF: | C7H3F3O2 | | MW: | 176.09 | | EINECS: | | | Product Categories: | Thiophenes;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;Miscellaneous;C7;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 2358-29-4.mol |  |
| | 2,3,6-TRIFLUOROBENZOIC ACID Chemical Properties |
| Melting point | 130-131 °C (lit.) | | Boiling point | 233.5±35.0 °C(Predicted) | | density | 1.536±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 2.00±0.10(Predicted) | | color | White to Almost white | | BRN | 2579153 | | InChI | InChI=1S/C7H3F3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) | | InChIKey | MGUPHQGQNHDGNK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(F)C=CC(F)=C1F | | CAS DataBase Reference | 2358-29-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,3,6-TRIFLUOROBENZOIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,3,6-Trifluorobenzoic acid is a trifluorinated analogue of Benzoic acid (B203900). 2,3,6-Trifluorobenzoic acid is a very useful synthetic intermediate that is commonly used to prepare inhibitors of malaria aspartyl proteases Plasmepsin I and II. | | General Description | Raman and FTIR spectra of the 2,3,6-tri-fluorobenzoic acid was studied. |
| | 2,3,6-TRIFLUOROBENZOIC ACID Preparation Products And Raw materials |
|