| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 4-Bromonicotinic acid
-
- $1.10
-
2026-08-20
- CAS:15366-62-8
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 4-Bromonicotinic acid Basic information | | Uses |
| | 4-Bromonicotinic acid Chemical Properties |
| Melting point | 118-134℃ | | Boiling point | 334.5±27.0 °C(Predicted) | | density | 1.813±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.85±0.10(Predicted) | | form | Solid | | color | Pale brown to dark brown | | InChI | InChI=1S/C6H4BrNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10) | | InChIKey | CZLOEKRJQIAKFI-UHFFFAOYSA-N | | SMILES | C1=NC=CC(Br)=C1C(O)=O | | CAS DataBase Reference | 15366-62-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT, KEEP COLD, STORED UNDER ARGON | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Bromonicotinic acid Usage And Synthesis |
| Uses | 4-Bromonicotinic acid and several related derivatives have been shown to inhibit streptococci, Staphylococcus aureus, Escherichia coli, and lactic acid bacteria. 4-Bromonicotinic acid can inhibit the growth of both Gram-positive and Gram-negative bacteria, but this inhibitory effect can be competitively reversed by nicotinic acid. The main function of 4-Bromonicotinic acid is to inhibit the synthesis of coenzyme precursors, such as nicotinic acid, nicotinamide, and nicotinamide riboside; while the synthesis of some coenzymes from nicotinamide riboside is inhibited, the absorption of these coenzymes is not affected, and the absorption rate is 2-3 μg/mg. |
| | 4-Bromonicotinic acid Preparation Products And Raw materials |
|