|
|
| | 3-Amino-2-fluorobenzoic acid Basic information |
| | 3-Amino-2-fluorobenzoic acid Chemical Properties |
| Boiling point | 325.9±27.0 °C(Predicted) | | density | 1.430 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 3.43±0.10(Predicted) | | color | Light orange to brown | | InChI | InChI=1S/C7H6FNO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,9H2,(H,10,11) | | InChIKey | WZCZMWMNVHEBCK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(N)=C1F |
| | 3-Amino-2-fluorobenzoic acid Usage And Synthesis |
| Definition | 3-Amino-2-fluorobenzoic acid is a valuable compound that the reduction of 2-Fluoro-3-nitrobenzoic acid can obtain. At the same time, 3-Amino-2-fluorobenzoic acid can also be used to synthesize compounds such as (3-Amino-2-fluorophenyl)methanol. |
| | 3-Amino-2-fluorobenzoic acid Preparation Products And Raw materials |
|