| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | L-ALANINE (U-13C3) Basic information |
| | L-ALANINE (U-13C3) Chemical Properties |
| Melting point | 314.5 °C (dec.) (lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +14.5, c = 2 in 1 M HCl | | InChI | 1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1 | | InChIKey | QNAYBMKLOCPYGJ-GCCOVPGMSA-N | | SMILES | [H][13C@@]([13CH3])(N)[13C](O)=O | | CAS Number Unlabeled | 56-41-7 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-ALANINE (U-13C3) Usage And Synthesis |
| Uses | L-Alanine-13C3 is the isotope labelled analog of L-Alanine (A481500); a compound used to make in-vivo measurement of glucose and alanine metabolism in studies of patients with diabetes. L-Alanine is a non-essential amino acid for human development and is one of the 20 amino acids encoded by the genetic code. |
| | L-ALANINE (U-13C3) Preparation Products And Raw materials |
|