| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- BOC-D-PRO-OME
-
- $1.00
-
2019-12-20
- CAS:73323-65-6
- Min. Order: 1KG
- Purity: 99%
|
| | Boc-D-Pro-OMe Basic information |
| Product Name: | Boc-D-Pro-OMe | | Synonyms: | BOC-D-PROLINE METHYL ESTER;BOC-D-PYRD(2)-OME;R-1-BOC-PYRROLIDINE-2-CARBOXYLIC ACID METHYL ESTER;N-ALPHA-T-BUTOXYCARBONYL-D-PROLINE METHYL ESTER;N-ALPHA-T-BUTOXYCARBONYL-D-PYRROLIDINE-2-CARBOXYLIC ACID METHYL ESTER;N-tert-Butoxycarbonyl-D-Proline methyl ester;BOC-D-PROLINE METHYLESTER LIQUID;N-BOC-D-PROLINE METHYL ESTER | | CAS: | 73323-65-6 | | MF: | C11H19NO4 | | MW: | 229.27 | | EINECS: | 233-720-0 | | Product Categories: | Pyrrole&Pyrrolidine&Pyrroline | | Mol File: | 73323-65-6.mol |  |
| | Boc-D-Pro-OMe Chemical Properties |
| Boiling point | 288.6±33.0 °C(Predicted) | | density | 1.120±0.06 g/cm3(Predicted) | | refractive index | 1.4510-1.4550 | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in DMSO. | | pka | -3.35±0.40(Predicted) | | form | Oil | | color | Clear Colourless | | Optical Rotation | 59.8°(C=0.01g/ml MEOH) | | InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h8H,5-7H2,1-4H3/t8-/m1/s1 | | InChIKey | WVDGSSCWFMSRHN-MRVPVSSYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H]1C(OC)=O | | CAS DataBase Reference | 73323-65-6(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2933998090 |
| | Boc-D-Pro-OMe Usage And Synthesis |
| Uses | N-Boc-D-proline methyl ester is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff fields. | | Synthesis | To a mixture of (R)-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid (5.8 g, 27 mmol) and potassium carbonate (8.6 g, 62 mmol) in tetrahydrofuran (160 mL) was added iodomethane (4.0 mL, 65 mmol). The reaction mixture was heated to reflux for 17 hours and subsequently cooled to room temperature. The reaction mixture was filtered and the filtrate was concentrated under reduced pressure. The crude product was purified by automated column chromatography using petroleum ether/ethyl acetate (3:1, v/v) as eluent to afford (R)-1-tert-butyl 2-methyl pyrrolidine-1,2-dicarboxylate (6.0 g, 65% yield) as a yellow oil. | | References | [1] Patent: WO2013/131018, 2013, A1. Location in patent: Page/Page column 38 |
| | Boc-D-Pro-OMe Preparation Products And Raw materials |
|