|
|
| | 4-Bromophenylhydrazine hydrochloride Basic information |
| | 4-Bromophenylhydrazine hydrochloride Chemical Properties |
| Melting point | 220-230 °C (dec.)(lit.) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | Light gray to light brown-beige | | Water Solubility | Soluble in water. | | Sensitive | Hygroscopic | | BRN | 3565838 | | InChI | InChI=1S/C6H7BrN2.ClH/c7-5-1-3-6(9-8)4-2-5;/h1-4,9H,8H2;1H | | InChIKey | RGGOWBBBHWTTRE-UHFFFAOYSA-N | | SMILES | N(C1=CC=C(Br)C=C1)N.[H]Cl | | CAS DataBase Reference | 622-88-8(CAS DataBase Reference) | | EPA Substance Registry System | Hydrazine, (4-bromophenyl)-, monohydrochloride (622-88-8) |
| Hazard Codes | C,Xi,T | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-28A | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | MV0800000 | | TSCA | TSCA listed | | HazardClass | IRRITANT, TOXIC | | PackingGroup | Ⅱ | | HS Code | 29280090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 4-Bromophenylhydrazine hydrochloride Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 4-Bromophenylhydrazine hydrochloride is used as a reagent in the preparation of acylsulfonamides, acylsulfamides and 9-bromo-2-ethenyl-7,12-dihydroindolo[3,2-d][1]benzazepin-6(5H)-one. | | Uses | 4-Bromophenylhydrazine hydrochloride was used as reagent in the synthesis of:
- acylsulfonamides and acylsulfamides
- 9-bromo-2-ethenyl-7,12-dihydroindolo[3,2-d][1]benzazepin-6(5H)-one
|
| | 4-Bromophenylhydrazine hydrochloride Preparation Products And Raw materials |
| Preparation Products | 7-BROMO-1,2,3,4-TETRAHYDROCYCLOPENTA[B]INDOLE-->5-BROMO-3-METHYLINDOLE-->2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-->6-BROMO-2,3,4,9-TETRAHYDRO-1H-CARBAZOL-1-ONE-->5-Bromoindole-2-carboxylic acid methyl ester-->Ethyl 5-Bromoindole-2-carboxylate-->5-BroMo-3-Methyl-2-phenyl-1H-indole-->5-AMINO-1-(4-BROMO-PHENYL)-1H-PYRAZOLE-4-CARBOXYLIC ACID-->2-(4-Bromo-phenyl)-2H-phthalazin-1-one |
|